Compound Q&A

What is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3)?

Answer

6-(3-Fluorophenyl)picolinic acid
6-(3-Fluorophenyl)picolinic acid is an organic compound with the CAS number 887982-40-3. It is a derivative of picolinic acid with a 3-fluorophenyl substituent. This compound is characterized by its acidic properties and is used in pharmaceutical research and development.

About

English Name 6-(3-Fluorophenyl)picolinic acid
Molecular Formula C12H8FNO2
Molecular Weight 217.19899999999998 g/mol
SMILES C1=CC(=CC(=C1)F)C2=NC(=CC=C2)C(=O)O
InChIKey LNVROFCFAZOMJU-UHFFFAOYSA-N
Last Updated: 2025-12-30 13:38

Related Q&A

Compound Q&A

What are the main uses of 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3)?

6-(3-Fluorophenyl)picolinic acid is primarily used in pharmaceutical research for developing potenti...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use when handled with a...

Compound Q&A

How should 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) be stored?

6-(3-Fluorophenyl)picolinic acid should be stored in a cool, dry place away from direct sunlight and...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...