Compound Q&A

Is E932098 (CAS: 1708092-13-0) safe?

Answer

E932098
E932098 (CAS: 1708092-13-0) is generally considered safe when handled with appropriate precautions. Users should wear protective equipment such as gloves and goggles, and follow safety guidelines to minimize exposure. Storage and disposal should also comply with local regulations.

About

English Name E932098
Molecular Formula C26H44O4
Molecular Weight 420.63 g/mol
SMILES O[C@H]1[C@@H](CC)[C@@H]2C[C@@H](CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCC(=O)O)CC[C@H]3[C@@H]21)O
InChIKey ZXERDUOLZKYMJM-QJBYOJSOSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What is E932098 (CAS: 1708092-13-0)?

E932098 (CAS: 1708092-13-0) is a complex organic compound with potential applications in various ind...

Compound Q&A

What are the main uses of E932098 (CAS: 1708092-13-0)?

E932098 (CAS: 1708092-13-0) is primarily used in research and development, pharmaceuticals, and indu...

Compound Q&A

How should E932098 (CAS: 1708092-13-0) be stored?

E932098 (CAS: 1708092-13-0) should be stored in a cool, dry environment away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...