Compound Q&A

What are the main uses of E932098 (CAS: 1708092-13-0)?

Answer

E932098
E932098 (CAS: 1708092-13-0) is primarily used in research and development, pharmaceuticals, and industrial applications. It serves as a catalyst, stabilizer, and functional additive in various products, enhancing their performance and stability.

About

English Name E932098
Molecular Formula C26H44O4
Molecular Weight 420.63 g/mol
SMILES O[C@H]1[C@@H](CC)[C@@H]2C[C@@H](CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCC(=O)O)CC[C@H]3[C@@H]21)O
InChIKey ZXERDUOLZKYMJM-QJBYOJSOSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What is E932098 (CAS: 1708092-13-0)?

E932098 (CAS: 1708092-13-0) is a complex organic compound with potential applications in various ind...

Compound Q&A

Is E932098 (CAS: 1708092-13-0) safe?

E932098 (CAS: 1708092-13-0) is generally considered safe when handled with appropriate precautions. ...

Compound Q&A

How should E932098 (CAS: 1708092-13-0) be stored?

E932098 (CAS: 1708092-13-0) should be stored in a cool, dry environment away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...