Compound Q&A

Is 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) safe?

Answer

2-Chloro-3-(trifluoromethyl)isonicotinic acid
2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) is generally considered safe when handled with proper precautions. It is important to follow standard safety guidelines, such as wearing protective gear and ensuring proper ventilation when working with this compound.

About

English Name 2-Chloro-3-(trifluoromethyl)isonicotinic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES c1cnc(c(c1C(=O)O)C(F)(F)F)Cl
InChIKey DIPOFUPESWIQSO-UHFFFAOYSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What is 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7)?

2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) is a colorless to white crystallin...

Compound Q&A

What are the main uses of 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7)?

2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) is primarily used as an intermedia...

Compound Q&A

How should 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) be stored?

2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) should be stored in a tightly seal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...