Compound Q&A

What are the main uses of 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7)?

Answer

2-Chloro-3-(trifluoromethyl)isonicotinic acid
2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It also serves as a reference compound in research and development.

About

English Name 2-Chloro-3-(trifluoromethyl)isonicotinic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES c1cnc(c(c1C(=O)O)C(F)(F)F)Cl
InChIKey DIPOFUPESWIQSO-UHFFFAOYSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What is 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7)?

2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) is a colorless to white crystallin...

Compound Q&A

Is 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) safe?

2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) is generally considered safe when ...

Compound Q&A

How should 2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) be stored?

2-Chloro-3-(trifluoromethyl)isonicotinic acid (CAS: 1227587-24-7) should be stored in a tightly seal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...