Compound Q&A

How should 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6) be stored?

Answer

3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
This compound should be stored in a cool, dry place away from direct sunlight and moisture. It should be kept in a sealed container to prevent degradation. Proper ventilation is also recommended to minimize the risk of exposure.

About

CAS No 36897-94-6
English Name 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
Molecular Formula C10H12O4
Molecular Weight 196.2 g/mol
SMILES COC(=O)C1C2CC(C1C(=O)O)C=C2
InChIKey JYZKYCYHXBQTCY-UHFFFAOYSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What is 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6)?

3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid is a cyclic unsaturated carboxylic aci...

Compound Q&A

What are the main uses of 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6)?

This compound is primarily used as an intermediary in the synthesis of pharmaceuticals and other org...

Compound Q&A

Is 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6) safe?

This compound is generally considered safe for laboratory use when proper handling and safety protoc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...