Compound Q&A

What are the main uses of 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6)?

Answer

3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
This compound is primarily used as an intermediary in the synthesis of pharmaceuticals and other organic compounds. It also finds applications in the development of certain types of polymers and as a research reagent.

About

CAS No 36897-94-6
English Name 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid
Molecular Formula C10H12O4
Molecular Weight 196.2 g/mol
SMILES COC(=O)C1C2CC(C1C(=O)O)C=C2
InChIKey JYZKYCYHXBQTCY-UHFFFAOYSA-N
Last Updated: 2025-12-30 09:27

Related Q&A

Compound Q&A

What is 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6)?

3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid is a cyclic unsaturated carboxylic aci...

Compound Q&A

Is 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6) safe?

This compound is generally considered safe for laboratory use when proper handling and safety protoc...

Compound Q&A

How should 3-(Methoxycarbonyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (CAS: 36897-94-6) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and moisture. It shoul...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...