Compound Q&A

How is (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7) typically synthesized?

Answer

(1S)-1-(3-Nitrophenyl)ethanamine
(1S)-1-(3-Nitrophenyl)ethanamine can be synthesized by the reaction of 3-nitrophenol with ethylamine in the presence of a base like sodium hydroxide. The reaction proceeds via an alkyl substitution mechanism, yielding a high yield of the desired product. The process is typically conducted under mild conditions to ensure selectivity and yield.

About

English Name (1S)-1-(3-Nitrophenyl)ethanamine
Molecular Formula C8H10N2O2
Molecular Weight 166.18 g/mol
SMILES CC(C1=CC(=CC=C1)[N+](=O)[O-])N
InChIKey AVIBPONLEKDCPQ-LURJTMIESA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7)?

(1S)-1-(3-Nitrophenyl)ethanamine is a crystalline solid with a molecular weight of approximately 185...

Compound Q&A

What industries use (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7)?

(1S)-1-(3-Nitrophenyl)ethanamine finds applications in various industries, particularly in the pharm...

Compound Q&A

What precautions should be taken when handling (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7)?

When handling (1S)-1-(3-Nitrophenyl)ethanamine, it is important to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...