Compound Q&A

What are the physical and chemical properties of (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7)?

Answer

(1S)-1-(3-Nitrophenyl)ethanamine
(1S)-1-(3-Nitrophenyl)ethanamine is a crystalline solid with a molecular weight of approximately 185.11 g/mol. It has a pKa of around 8.5 and is poorly soluble in water but more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, especially under basic conditions, and can undergo substitution reactions. It sublimes readily and has a distinct odor.

About

English Name (1S)-1-(3-Nitrophenyl)ethanamine
Molecular Formula C8H10N2O2
Molecular Weight 166.18 g/mol
SMILES CC(C1=CC(=CC=C1)[N+](=O)[O-])N
InChIKey AVIBPONLEKDCPQ-LURJTMIESA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7) typically synthesized?

(1S)-1-(3-Nitrophenyl)ethanamine can be synthesized by the reaction of 3-nitrophenol with ethylamine...

Compound Q&A

What industries use (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7)?

(1S)-1-(3-Nitrophenyl)ethanamine finds applications in various industries, particularly in the pharm...

Compound Q&A

What precautions should be taken when handling (1S)-1-(3-Nitrophenyl)ethanamine (CAS: 297730-25-7)?

When handling (1S)-1-(3-Nitrophenyl)ethanamine, it is important to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...