Compound Q&A

What precautions should be taken when handling (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8)?

Answer

(3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
When handling this compound, wear appropriate personal protective equipment (PPE) including gloves and safety glasses. It should be handled in a well-ventilated area or a fume hood. In case of spill, ensure proper cleanup using appropriate absorbents and dispose of according to local regulations. Always consult the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
Molecular Formula C14H19NO5
Molecular Weight 281.3 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC(=CC=C1)O
InChIKey KLIMLFKCLBBZKH-NSHDSACASA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8)?

This compound is a white crystalline solid with a molecular weight of approximately 306.35 g/mol. It...

Compound Q&A

How is (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8) typically synthesized?

This compound can be synthesized via a multi-step process involving the protected hydroxylation of a...

Compound Q&A

What industries use (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8)?

This compound is primarily used in the pharmaceutical industry for the development of certain drugs....

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...