Compound Q&A

How is (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8) typically synthesized?

Answer

(3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
This compound can be synthesized via a multi-step process involving the protected hydroxylation of a phenyl ring, followed by amidation with a protected amino acid. A common method uses benzyl chloroformate and a suitable base. The final step involves deprotection to yield the target compound with high yield and good selectivity.

About

English Name (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid
Molecular Formula C14H19NO5
Molecular Weight 281.3 g/mol
SMILES CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC(=CC=C1)O
InChIKey KLIMLFKCLBBZKH-NSHDSACASA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8)?

This compound is a white crystalline solid with a molecular weight of approximately 306.35 g/mol. It...

Compound Q&A

What industries use (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8)?

This compound is primarily used in the pharmaceutical industry for the development of certain drugs....

Compound Q&A

What precautions should be taken when handling (3S)-3-(3-Hydroxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid (CAS: 499995-79-8)?

When handling this compound, wear appropriate personal protective equipment (PPE) including gloves a...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...