Compound Q&A

What industries use 2-Fluoro-4-formylbenzoic acid (CAS: 604000-97-7)?

Answer

2-Fluoro-4-formylbenzoic acid
2-Fluoro-4-formylbenzoic acid is used in the pharmaceutical industry for the synthesis of certain drug precursors and intermediates. It also finds applications in the polymer industry, where it is used as a monomer in the production of functional polymers. Additionally, it is employed in the development of sensors and semiconductors for its specific chemical properties.

About

English Name 2-Fluoro-4-formylbenzoic acid
Molecular Formula C8H5FO3
Molecular Weight 168.12 g/mol
SMILES C1=CC(=C(C=C1C=O)F)C(=O)O
InChIKey MBTIUAFUJPATDP-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-formylbenzoic acid (CAS: 604000-97-7)?

2-Fluoro-4-formylbenzoic acid is a crystalline solid with a molecular weight of approximately 183.05...

Compound Q&A

How is 2-Fluoro-4-formylbenzoic acid (CAS: 604000-97-7) typically synthesized?

2-Fluoro-4-formylbenzoic acid is typically synthesized from 4-formylbenzoic acid via a halogenation ...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-formylbenzoic acid (CAS: 604000-97-7)?

When handling 2-Fluoro-4-formylbenzoic acid, it is important to wear protective equipment such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...