Compound Q&A

What are the physical and chemical properties of 3'-Cytidylic acid (CAS: 84-52-6)?

Answer

3'-Cytidylic acid
3'-Cytidylic acid (CAS: 84-52-6) is a white, crystalline solid with a molecular weight of approximately 266.21 g/mol. It is poorly soluble in water but soluble in ethanol. The acid is relatively stable under normal conditions but is reactive under basic conditions. It is often used in nucleotide chemistry and biological research.

About

CAS No 84-52-6
English Name 3'-Cytidylic acid
Molecular Formula C9H14N3O8P
Molecular Weight 323.2 g/mol
SMILES c1cn(c(=O)nc1N)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)OP(=O)(O)O)O
InChIKey UOOOPKANIPLQPU-XVFCMESISA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is 3'-Cytidylic acid (CAS: 84-52-6) typically synthesized?

3'-Cytidylic acid can be synthesized through the condensation of cytidine with phosphate in the pres...

Compound Q&A

What industries use 3'-Cytidylic acid (CAS: 84-52-6)?

3'-Cytidylic acid (CAS: 84-52-6) is primarily used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling 3'-Cytidylic acid (CAS: 84-52-6)?

When handling 3'-Cytidylic acid (CAS: 84-52-6), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...