Compound Q&A

What industries use Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3)?

Answer

Benzene,1,2,3,4,5-pentabromo-6-ethyl-
Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) is used in the pharmaceutical industry for the synthesis of certain medications, in the polymer industry for developing novel materials, and in the semiconductor industry for manufacturing electronic components. It also has applications in sensing technologies due to its unique chemical properties.

About

CAS No 85-22-3
English Name Benzene,1,2,3,4,5-pentabromo-6-ethyl-
Molecular Formula C8H5Br5
Molecular Weight 500.65 g/mol
SMILES CCc1c(Br)c(Br)c(c(c1Br)Br)Br
InChIKey FIAXCDIQXHJNIX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3)?

Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) is a crystalline solid with a high molecular we...

Compound Q&A

How is Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) typically synthesized?

Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) is typically synthesized through a series of ha...

Compound Q&A

What precautions should be taken when handling Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3)?

When handling Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3), ensure the use of appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...