Compound Q&A

What are the physical and chemical properties of Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3)?

Answer

Benzene,1,2,3,4,5-pentabromo-6-ethyl-
Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) is a crystalline solid with a high molecular weight due to the bromine and ethyl groups. It has a low solubility in water but is more soluble in organic solvents. This compound is highly reactive due to its bromine substituents, making it prone to halogenation reactions. It is less reactive towards other common organic reactions compared to benzene.

About

CAS No 85-22-3
English Name Benzene,1,2,3,4,5-pentabromo-6-ethyl-
Molecular Formula C8H5Br5
Molecular Weight 500.6453 g/mol
SMILES CCc1c(Br)c(Br)c(c(c1Br)Br)Br
InChIKey FIAXCDIQXHJNIX-UHFFFAOYSA-N
Last Updated: 2025-12-29 01:16

Related Q&A

Compound Q&A

How is Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) typically synthesized?

Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) is typically synthesized through a series of ha...

Compound Q&A

What industries use Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3)?

Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3) is used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3)?

When handling Benzene,1,2,3,4,5-pentabromo-6-ethyl- (CAS: 85-22-3), ensure the use of appropriate pe...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...