Compound Q&A

What industries use Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

Answer

Ethyl 4,6-dichloro-5-fluoronicotinate
Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the chemical industry for its use as an intermediate in the synthesis of other compounds. Some specific applications include its role in the development of antimicrobial and antiviral agents.

About

English Name Ethyl 4,6-dichloro-5-fluoronicotinate
Molecular Formula C8H6Cl2FNO2
Molecular Weight 238.045 g/mol
SMILES CCOC(=O)C1=CN=C(C(=C1Cl)F)Cl
InChIKey PJAYGSDXQHYXNZ-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is a solid at room temperature with a cryst...

Compound Q&A

How is Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) typically synthesized?

Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is typically synthesized via a multi-step p...

Compound Q&A

What precautions should be taken when handling Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

When handling Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6), it is important to wear appr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...