Compound Q&A

How is Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) typically synthesized?

Answer

Ethyl 4,6-dichloro-5-fluoronicotinate
Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is typically synthesized via a multi-step process involving the preparation of 4,6-dichloro-5-fluoronicotinic acid and its subsequent esterification with ethyl alcohol. This process includes careful control of reaction conditions to achieve high yield and selectivity. Catalysts such as sulfuric acid are often used in the esterification step.

About

English Name Ethyl 4,6-dichloro-5-fluoronicotinate
Molecular Formula C8H6Cl2FNO2
Molecular Weight 238.045 g/mol
SMILES CCOC(=O)C1=CN=C(C(=C1Cl)F)Cl
InChIKey PJAYGSDXQHYXNZ-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is a solid at room temperature with a cryst...

Compound Q&A

What industries use Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

When handling Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6), it is important to wear appr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...