Compound Q&A

What are the physical and chemical properties of Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

Answer

Ethyl 4,6-dichloro-5-fluoronicotinate
Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is a solid at room temperature with a crystalline form. Its molecular weight is approximately 319.04 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and dichloromethane. The compound is moderately reactive, particularly with nucleophiles, and is used in organic synthesis. It is not flammable but can react with strong reducing agents under certain conditions.

About

English Name Ethyl 4,6-dichloro-5-fluoronicotinate
Molecular Formula C8H6Cl2FNO2
Molecular Weight 238.045 g/mol
SMILES CCOC(=O)C1=CN=C(C(=C1Cl)F)Cl
InChIKey PJAYGSDXQHYXNZ-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) typically synthesized?

Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is typically synthesized via a multi-step p...

Compound Q&A

What industries use Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6) is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6)?

When handling Ethyl 4,6-dichloro-5-fluoronicotinate (CAS: 154012-17-6), it is important to wear appr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...