Compound Q&A

What industries use CID 129627372 (CAS: 1190105-65-7)?

Answer

CID 129627372
CID 129627372 (CAS: 1190105-65-7) is primarily used in the pharmaceutical industry for developing new drugs. It also finds applications in the polymer industry for enhancing material properties, in sensor technology for detecting specific chemicals, and in semiconductor manufacturing for its stable electronic properties.

About

English Name CID 129627372
Molecular Formula C32H53BrN2O3
Molecular Weight 593.68 g/mol
SMILES CC(=O)OC1C(CC2C1(CCC3C2CCC4C3(CC(C(C4)O)N5CCCC5)C)C)[N+]6(CCCC6)CC=C.[Br-]
InChIKey WXZVCMSZGNGDKJ-GYFLCYNPSA-M
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of CID 129627372 (CAS: 1190105-65-7)?

CID 129627372 (CAS: 1190105-65-7) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is CID 129627372 (CAS: 1190105-65-7) typically synthesized?

CID 129627372 (CAS: 1190105-65-7) is synthesized through a multistep process involving condensation ...

Compound Q&A

What precautions should be taken when handling CID 129627372 (CAS: 1190105-65-7)?

When handling CID 129627372 (CAS: 1190105-65-7), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...