Compound Q&A

How is CID 129627372 (CAS: 1190105-65-7) typically synthesized?

Answer

CID 129627372
CID 129627372 (CAS: 1190105-65-7) is synthesized through a multistep process involving condensation reactions and derivatization. Common catalysts include phosphoric acid. The synthesis yields a high-purity product with excellent selectivity, making it suitable for detailed chemical analysis.

About

English Name CID 129627372
Molecular Formula C32H53BrN2O3
Molecular Weight 593.68 g/mol
SMILES CC(=O)OC1C(CC2C1(CCC3C2CCC4C3(CC(C(C4)O)N5CCCC5)C)C)[N+]6(CCCC6)CC=C.[Br-]
InChIKey WXZVCMSZGNGDKJ-GYFLCYNPSA-M
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of CID 129627372 (CAS: 1190105-65-7)?

CID 129627372 (CAS: 1190105-65-7) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use CID 129627372 (CAS: 1190105-65-7)?

CID 129627372 (CAS: 1190105-65-7) is primarily used in the pharmaceutical industry for developing ne...

Compound Q&A

What precautions should be taken when handling CID 129627372 (CAS: 1190105-65-7)?

When handling CID 129627372 (CAS: 1190105-65-7), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...