Compound Q&A

What industries use Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5)?

Answer

Potassium tri(1H-imidazol-1-yl)hydroborate
Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) is primarily used in the pharmaceutical industry for the synthesis of various organic compounds and boron-containing drugs. It is also employed in the polymer industry for the modification of polymers and in the electronics industry for the production of semiconductors. Additionally, it finds applications in the development of sensors and as a reagent in organic synthesis.

About

CAS No 98047-23-5
English Name Potassium tri(1H-imidazol-1-yl)hydroborate
Molecular Formula C9H10BKN6
Molecular Weight 252.13 g/mol
SMILES [B-](N1C=CN=C1)(N2C=CN=C2)N3C=CN=C3.[K+]
InChIKey GWYHSUYRPGOWCB-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5)?

Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) is a crystalline solid with a molecular...

Compound Q&A

How is Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) typically synthesized?

Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) is typically synthesized by the reactio...

Compound Q&A

What precautions should be taken when handling Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5)?

When handling Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...