Compound Q&A

How is Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) typically synthesized?

Answer

Potassium tri(1H-imidazol-1-yl)hydroborate
Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) is typically synthesized by the reaction of potassium tert-butoxide with 1-tert-butylimidazole in a hydroborate-forming reaction. The process involves the formation of a complex intermediate that is then treated with boron hydride to generate the final product. This method provides good selectivity and yield under mild conditions.

About

CAS No 98047-23-5
English Name Potassium tri(1H-imidazol-1-yl)hydroborate
Molecular Formula C9H10BKN6
Molecular Weight 252.13 g/mol
SMILES [B-](N1C=CN=C1)(N2C=CN=C2)N3C=CN=C3.[K+]
InChIKey GWYHSUYRPGOWCB-UHFFFAOYSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5)?

Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) is a crystalline solid with a molecular...

Compound Q&A

What industries use Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5)?

Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5)?

When handling Potassium tri(1H-imidazol-1-yl)hydroborate (CAS: 98047-23-5), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...