Compound Q&A

What are the physical and chemical properties of (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

Answer

(4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane
The compound (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8) has a crystalline form, with a molecular weight of approximately 220.24 g/mol. It is poorly soluble in water but readily soluble in organic solvents. This compound exhibits reactive carbonyl functionality, making it susceptible to nucleophilic attack. It is stable under normal conditions but should be stored in a cool, dry place away from strong acids and bases.

About

CAS No 59779-75-8
English Name (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane
Molecular Formula C11H18O6
Molecular Weight 246.25899999999996 g/mol
SMILES CCOC(=O)C1C(OC(O1)(C)C)C(=O)OCC
InChIKey MCNKHXZIPATURB-HTQZYQBOSA-N
Last Updated: 2025-12-28 19:55

Related Q&A

Compound Q&A

How is (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8) typically synthesized?

The compound (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8) is typically synth...

Compound Q&A

What industries use (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

The compound (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8) is used in various...

Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8), it is essential ...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...