Compound Q&A

What industries use Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9)?

Answer

Chloromethyl 2-methyl-2-propanyl succinate
Chloromethyl 2-methyl-2-propanyl succinate is used in various industries, including pharmaceuticals, where it serves as a precursor for medicinal compounds. It is also utilized in the polymer industry for modifying the properties of polymers and in the production of sensors and semiconductors for its specific chemical and physical properties.

About

English Name Chloromethyl 2-methyl-2-propanyl succinate
Molecular Formula C9H15ClO4
Molecular Weight 222.67 g/mol
SMILES CC(C)(C)OC(=O)CCC(=O)OCCl
InChIKey ZEHMWPBRDVLBMH-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9)?

Chloromethyl 2-methyl-2-propanyl succinate has a white crystalline appearance with a molecular weigh...

Compound Q&A

How is Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9) typically synthesized?

Chloromethyl 2-methyl-2-propanyl succinate is typically synthesized via an esterification reaction b...

Compound Q&A

What precautions should be taken when handling Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9)?

When handling Chloromethyl 2-methyl-2-propanyl succinate, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...