Compound Q&A

How is Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9) typically synthesized?

Answer

Chloromethyl 2-methyl-2-propanyl succinate
Chloromethyl 2-methyl-2-propanyl succinate is typically synthesized via an esterification reaction between 2-methyl-2-propanol and succinic acid in the presence of a catalyst such as sulfuric acid. The reaction is performed at elevated temperatures to achieve high selectivity and yield. The product is then purified by recrystallization from an appropriate solvent.

About

English Name Chloromethyl 2-methyl-2-propanyl succinate
Molecular Formula C9H15ClO4
Molecular Weight 222.67 g/mol
SMILES CC(C)(C)OC(=O)CCC(=O)OCCl
InChIKey ZEHMWPBRDVLBMH-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9)?

Chloromethyl 2-methyl-2-propanyl succinate has a white crystalline appearance with a molecular weigh...

Compound Q&A

What industries use Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9)?

Chloromethyl 2-methyl-2-propanyl succinate is used in various industries, including pharmaceuticals,...

Compound Q&A

What precautions should be taken when handling Chloromethyl 2-methyl-2-propanyl succinate (CAS: 432037-43-9)?

When handling Chloromethyl 2-methyl-2-propanyl succinate, it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...