Compound Q&A

What industries use 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3)?

Answer

2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate
This compound is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It may also find applications in the polymer industry for the development of advanced materials and in the electronics sector for the production of sensors and semiconductors.

About

English Name 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate
Molecular Formula C18H22BrN3O2
Molecular Weight 392.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCC[C@H]1c2[nH]c(cn2)c3ccc(cc3)Br
InChIKey SEJWRHUDDTVGHP-HNNXBMFYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3)?

This compound is a crystalline solid with a molecular weight of approximately 442.17 g/mol. It has a...

Compound Q&A

How is 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3) typically synthesized?

This compound can be synthesized via a multi-step process involving the condensation of 4-bromopheny...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...