Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3)?

Answer

2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate
This compound is a crystalline solid with a molecular weight of approximately 442.17 g/mol. It has a low solubility in water but is more soluble in organic solvents. It is moderately reactive, especially towards nucleophiles. It exhibits good thermal stability and is stable under normal storage conditions.

About

English Name 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate
Molecular Formula C18H22BrN3O2
Molecular Weight 392.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCC[C@H]1c2[nH]c(cn2)c3ccc(cc3)Br
InChIKey SEJWRHUDDTVGHP-HNNXBMFYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3) typically synthesized?

This compound can be synthesized via a multi-step process involving the condensation of 4-bromopheny...

Compound Q&A

What industries use 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3)?

This compound is primarily used in the pharmaceutical industry as an intermediate for the synthesis ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (2S)-2-[4-(4-bromophenyl)-1H-imidazol-2-yl]-1-pyrrolidinecarboxylate (CAS: 1007882-04-3)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...