Compound Q&A

How is Romifidine Hydrochloride (CAS: 65896-14-2) typically synthesized?

Answer

Romifidine Hydrochloride
Romifidine Hydrochloride (CAS: 65896-14-2) is synthesized through a multi-step process involving the condensation of a specific aromatic amine with an appropriate carboxylic acid derivative. The reaction is typically performed in the presence of an appropriate base and solvent, followed by treatment with hydrochloric acid to form the hydrochloride salt. The yield and selectivity of the process are influenced by the choice of reagents and reaction conditions.

About

CAS No 65896-14-2
English Name Romifidine Hydrochloride
Molecular Formula C9H10BrClFN3
Molecular Weight 294.56 g/mol
SMILES C1CN=C(N1)NC2=C(C=CC=C2Br)F.Cl
InChIKey SDXVSIWCVTYYQN-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of Romifidine Hydrochloride (CAS: 65896-14-2)?

Romifidine Hydrochloride (CAS: 65896-14-2) is a crystalline compound with a molecular weight of appr...

Compound Q&A

What industries use Romifidine Hydrochloride (CAS: 65896-14-2)?

Romifidine Hydrochloride (CAS: 65896-14-2) is primarily used in the pharmaceutical industry as an in...

Compound Q&A

What precautions should be taken when handling Romifidine Hydrochloride (CAS: 65896-14-2)?

When handling Romifidine Hydrochloride (CAS: 65896-14-2), it is important to use personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...