Compound Q&A

What are the physical and chemical properties of Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9)?

Answer

Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate
Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9) is a crystalline compound with a molecular weight of approximately 229.12 g/mol. It has a moderate solubility in common organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo nucleophilic substitution reactions. It is not flammable but requires caution due to its reactivity.

About

English Name Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate
Molecular Formula C8H10F2N2O2
Molecular Weight 204.18 g/mol
SMILES CCOC(=O)C1=C(N(N=C1)C)C(F)F
InChIKey AYCXDJXKBPZTTR-UHFFFAOYSA-N
Last Updated: 2025-12-28 14:56

Related Q&A

Compound Q&A

How is Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9) typically synthesized?

Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9) is typically synthesi...

Compound Q&A

What industries use Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9)?

Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9) finds applications in...

Compound Q&A

What precautions should be taken when handling Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9)?

When handling Ethyl 5-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate (CAS: 851725-98-9), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...