Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0)?

Answer

2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite
2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0) is a colorless viscous liquid with a high molecular weight. It has a low solubility in water but is soluble in organic solvents. It is moderately reactive and can undergo hydrolysis and other chemical transformations. This compound is stable under normal storage conditions but should be handled with care due to its reactivity.

About

English Name 2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite
Molecular Formula C16H37N2OP
Molecular Weight 304.46 g/mol
SMILES CC(C)N(C(C)C)P(N(C(C)C)C(C)C)OC(C)(C)C
InChIKey PSFUFSJCFKUIIG-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0) typically synthesized?

2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0) is synthesized th...

Compound Q&A

What industries use 2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0)?

2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0) is primarily used...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0)?

When handling 2-Methyl-2-propanyl N,N,N',N'-tetraisopropylphosphorodiamidoite (CAS: 137348-88-0), it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...