Compound Q&A

How is Potassium pentadecafluorooctanoate (CAS: 2395-00-8) typically synthesized?

Answer

Potassium pentadecafluorooctanoate
Potassium pentadecafluorooctanoate (CAS: 2395-00-8) is typically synthesized through the fluorination of octanoic acid followed by the reaction with potassium hydroxide. The process involves the use of a fluoride source and can be performed under an inert atmosphere to prevent side reactions. The yield and selectivity depend on the reaction conditions and catalysts used.

About

CAS No 2395-00-8
English Name Potassium pentadecafluorooctanoate
Molecular Formula C8F15KO2
Molecular Weight 201.3 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[K+]
InChIKey WPDDXKNWUVLZMQ-UHFFFAOYSA-M
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Potassium pentadecafluorooctanoate (CAS: 2395-00-8)?

Potassium pentadecafluorooctanoate (CAS: 2395-00-8) is a crystalline compound with a high molecular ...

Compound Q&A

What industries use Potassium pentadecafluorooctanoate (CAS: 2395-00-8)?

Potassium pentadecafluorooctanoate (CAS: 2395-00-8) is used in various industries due to its unique ...

Compound Q&A

What precautions should be taken when handling Potassium pentadecafluorooctanoate (CAS: 2395-00-8)?

When handling Potassium pentadecafluorooctanoate (CAS: 2395-00-8), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...