Compound Q&A

What are the physical and chemical properties of Potassium pentadecafluorooctanoate (CAS: 2395-00-8)?

Answer

Potassium pentadecafluorooctanoate
Potassium pentadecafluorooctanoate (CAS: 2395-00-8) is a crystalline compound with a high molecular weight and low solubility in water. It has a high reactivity with certain metals and can form stable complexes. The compound is known for its fluorine content, which contributes to its stability and unique physicochemical properties.

About

CAS No 2395-00-8
English Name Potassium pentadecafluorooctanoate
Molecular Formula C8F15KO2
Molecular Weight 201.3 g/mol
SMILES C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)[O-].[K+]
InChIKey WPDDXKNWUVLZMQ-UHFFFAOYSA-M
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is Potassium pentadecafluorooctanoate (CAS: 2395-00-8) typically synthesized?

Potassium pentadecafluorooctanoate (CAS: 2395-00-8) is typically synthesized through the fluorinatio...

Compound Q&A

What industries use Potassium pentadecafluorooctanoate (CAS: 2395-00-8)?

Potassium pentadecafluorooctanoate (CAS: 2395-00-8) is used in various industries due to its unique ...

Compound Q&A

What precautions should be taken when handling Potassium pentadecafluorooctanoate (CAS: 2395-00-8)?

When handling Potassium pentadecafluorooctanoate (CAS: 2395-00-8), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...