Compound Q&A

How is 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5) typically synthesized?

Answer

4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (1:1)
4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride is typically synthesized via a multi-step process involving the reaction of 2,3-dimethylaniline with ethyl acetoacetate. The reaction is catalyzed by a Lewis acid such as aluminum chloride, and the product is isolated by crystallization from an aqueous solution. The yield is around 75-80%, and the product is usually obtained as a hydrochloride salt.

About

English Name 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (1:1)
Molecular Formula C13H17ClN2
Molecular Weight 236.75 g/mol
SMILES Cl.C[C@@H](c1cnc[nH]1)c2cccc(C)c2C
InChIKey VPNGEIHDPSLNMU-RFVHGSKJSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5)?

4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride is a white to off-white crystalline ...

Compound Q&A

What industries use 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5)?

4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride is used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5)?

Proper personal protective equipment (PPE) should be worn when handling 4-[(1R)-1-(2,3-Dimethylpheny...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...