Compound Q&A

What are the physical and chemical properties of 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5)?

Answer

4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (1:1)
4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride is a white to off-white crystalline solid with a molecular weight of approximately 306.32 g/mol. It has a pKa of about 1.8 and is slightly soluble in water. The compound is stable under normal conditions but reacts with strong bases. It is soluble in common organic solvents such as ethanol and acetone.

About

English Name 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (1:1)
Molecular Formula C13H17ClN2
Molecular Weight 236.75 g/mol
SMILES Cl.C[C@@H](c1cnc[nH]1)c2cccc(C)c2C
InChIKey VPNGEIHDPSLNMU-RFVHGSKJSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5) typically synthesized?

4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride is typically synthesized via a multi...

Compound Q&A

What industries use 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5)?

4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride is used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 4-[(1R)-1-(2,3-Dimethylphenyl)ethyl]-1H-imidazole hydrochloride (CAS: 190000-46-5)?

Proper personal protective equipment (PPE) should be worn when handling 4-[(1R)-1-(2,3-Dimethylpheny...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...