Compound Q&A

How is Starch, oxidized (CAS: 65996-62-5) typically synthesized?

Answer

Starch, oxidized
Starch, oxidized (CAS: 65996-62-5) is synthesized through the oxidation of starch using chemical oxidants like potassium permanganate or hydrogen peroxide in the presence of a catalyst. The oxidation process typically occurs at elevated temperatures and involves the introduction of carboxyl groups into the starch molecules. This method enhances the reactivity of the starch, making it suitable for various applications.

About

CAS No 65996-62-5
English Name Starch, oxidized
Molecular Formula C27H46O20
Molecular Weight 690.64 g/mol
SMILES O1C(C(C(C(C1COC1C(C(C(C(CO)O1)OC)O)O)OC1C(C(C(C(CO)O1)OC)O)=O)O)O)OC1C(CO)OC(C)C(C1O)O
InChIKey XSFCCWULLRIRGA-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Starch, oxidized (CAS: 65996-62-5)?

Starch, oxidized (CAS: 65996-62-5) is a modified form of starch with increased solubility and reacti...

Compound Q&A

What industries use Starch, oxidized (CAS: 65996-62-5)?

Starch, oxidized (CAS: 65996-62-5) is widely used in the pharmaceutical, food, textile, and paper in...

Compound Q&A

What precautions should be taken when handling Starch, oxidized (CAS: 65996-62-5)?

When handling Starch, oxidized (CAS: 65996-62-5), it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...