Compound Q&A

What are the physical and chemical properties of Starch, oxidized (CAS: 65996-62-5)?

Answer

Starch, oxidized
Starch, oxidized (CAS: 65996-62-5) is a modified form of starch with increased solubility and reactivity due to the introduction of oxidized groups. It has a molecular weight ranging from 100,000 to 6,000,000 Da, depending on the degree of modification. This compound is soluble in hot water and has good film-forming properties. It reacts readily with various functional groups and can be used in a wide range of applications such as pharmaceuticals and food industry.

About

CAS No 65996-62-5
English Name Starch, oxidized
Molecular Formula C27H46O20
Molecular Weight 690.64 g/mol
SMILES O1C(C(C(C(C1COC1C(C(C(C(CO)O1)OC)O)O)OC1C(C(C(C(CO)O1)OC)O)=O)O)O)OC1C(CO)OC(C)C(C1O)O
InChIKey XSFCCWULLRIRGA-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is Starch, oxidized (CAS: 65996-62-5) typically synthesized?

Starch, oxidized (CAS: 65996-62-5) is synthesized through the oxidation of starch using chemical oxi...

Compound Q&A

What industries use Starch, oxidized (CAS: 65996-62-5)?

Starch, oxidized (CAS: 65996-62-5) is widely used in the pharmaceutical, food, textile, and paper in...

Compound Q&A

What precautions should be taken when handling Starch, oxidized (CAS: 65996-62-5)?

When handling Starch, oxidized (CAS: 65996-62-5), it is essential to wear appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...