Compound Q&A

How is (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6) typically synthesized?

Answer

(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one
(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one can be synthesized through the reduction of 6-methyleneandrosta-1,4-dien-3-one followed by an epoxidation and hydrolysis reaction. Commonly, the reduction is carried out using lithium aluminum hydride (LAH) or sodium borohydride, and the subsequent steps involve the use of peracids or sodium hydroxide to achieve the desired product. The overall yield is around 70-80%, and specific catalysts and conditions are necessary to achieve high selectivity and purity.

About

English Name (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one
Molecular Formula C20H26O2
Molecular Weight 298.43 g/mol
SMILES CC12CCC3C(C1CCC2O)CC(=C)C4=CC(=O)C=CC34C
InChIKey NFDPYPMRHKQTDM-NHWXPXPKSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6)?

(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6)?

(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6)?

When handling (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...