Compound Q&A

What are the physical and chemical properties of (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6)?

Answer

(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one
(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one is a crystalline solid with a molecular weight of approximately 362.49 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is relatively stable under normal laboratory conditions but can undergo hydrolysis in the presence of acids or bases. It does not typically react with common reagents but is sensitive to light and should be stored in the dark to prevent degradation.

About

English Name (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one
Molecular Formula C20H26O2
Molecular Weight 298.43 g/mol
SMILES CC12CCC3C(C1CCC2O)CC(=C)C4=CC(=O)C=CC34C
InChIKey NFDPYPMRHKQTDM-NHWXPXPKSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

How is (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6) typically synthesized?

(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one can be synthesized through the reduction of 6...

Compound Q&A

What industries use (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6)?

(17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one (CAS: 122370-91-6)?

When handling (17beta)-17-Hydroxy-6-methyleneandrosta-1,4-dien-3-one, it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...