Compound Q&A

What industries use CAY10465 (CAS: 688348-33-6)?

Answer

CAY10465
CAY10465 is primarily used in the pharmaceutical industry for the development of novel drugs. It also has applications in the polymer industry for enhancing material properties and in the semiconductor industry for its electronic properties. Additionally, it can be used in sensor applications due to its unique reactivity.

About

English Name CAY10465
Molecular Formula C15H9Cl2F3
Molecular Weight 317.14 g/mol
SMILES FC(c1ccc(cc1)C=Cc1cc(Cl)cc(c1)Cl)(F)F
InChIKey ISPYNXGXZRLLHM-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of CAY10465 (CAS: 688348-33-6)?

CAY10465 is a crystalline compound with a molecular weight of approximately 450 g/mol. It is slightl...

Compound Q&A

How is CAY10465 (CAS: 688348-33-6) typically synthesized?

CAY10465 is synthesized through a multi-step process involving the reaction of an amine with a carbo...

Compound Q&A

What precautions should be taken when handling CAY10465 (CAS: 688348-33-6)?

When handling CAY10465, it is important to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...