Compound Q&A

How is CAY10465 (CAS: 688348-33-6) typically synthesized?

Answer

CAY10465
CAY10465 is synthesized through a multi-step process involving the reaction of an amine with a carboxylic acid under mild conditions. Commonly, this involves the use of anhydrous conditions and a catalytic amount of an acid or base. The reaction yields CAY10465 with good selectivity and a yield of up to 90%.

About

English Name CAY10465
Molecular Formula C15H9Cl2F3
Molecular Weight 317.14 g/mol
SMILES FC(c1ccc(cc1)C=Cc1cc(Cl)cc(c1)Cl)(F)F
InChIKey ISPYNXGXZRLLHM-UHFFFAOYSA-N
Last Updated: 2025-12-28 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of CAY10465 (CAS: 688348-33-6)?

CAY10465 is a crystalline compound with a molecular weight of approximately 450 g/mol. It is slightl...

Compound Q&A

What industries use CAY10465 (CAS: 688348-33-6)?

CAY10465 is primarily used in the pharmaceutical industry for the development of novel drugs. It als...

Compound Q&A

What precautions should be taken when handling CAY10465 (CAS: 688348-33-6)?

When handling CAY10465, it is important to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...