Compound Q&A

What industries use 5-Methoxy-6-nitro-1H-indazole (CAS: 724767-15-1)?

Answer

5-Methoxy-6-nitro-1H-indazole
5-Methoxy-6-nitro-1H-indazole (CAS: 724767-15-1) has applications in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also used in the development of sensors for detecting various chemicals and in the semiconductor industry for specific applications in electronic devices. Its use in polymer chemistry is limited but it can be incorporated into certain polymer systems for enhanced properties.

About

English Name 5-Methoxy-6-nitro-1H-indazole
Molecular Formula C8H7N3O3
Molecular Weight 193.16 g/mol
SMILES COC1=C(C=C2C(=C1)C=NN2)[N+](=O)[O-]
InChIKey NGZRHTSGWGCDDC-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Methoxy-6-nitro-1H-indazole (CAS: 724767-15-1)?

5-Methoxy-6-nitro-1H-indazole (CAS: 724767-15-1) is a crystalline solid with a molecular weight of a...

Compound Q&A

How is 5-Methoxy-6-nitro-1H-indazole (CAS: 724767-15-1) typically synthesized?

5-Methoxy-6-nitro-1H-indazole is typically synthesized through the nitration of 5-methoxy-1H-indazol...

Compound Q&A

What precautions should be taken when handling 5-Methoxy-6-nitro-1H-indazole (CAS: 724767-15-1)?

When handling 5-Methoxy-6-nitro-1H-indazole (CAS: 724767-15-1), it is important to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...