Compound Q&A

How is iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1) typically synthesized?

Answer

Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1)
Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) is synthesized through the reaction of palladium(II) iodide with tris(2-methyl-2-propanyl)phosphine. This process involves the use of a mild reducing agent to form a stable complex, which is crucial for its reactivity and application in catalysis.

About

English Name Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1)
Molecular Formula C24H54I2P2Pd2
Molecular Weight 871.29 g/mol
SMILES [I]1[Pd][I][Pd]1.CC(P(C(C)(C)C)C(C)(C)C)(C)C.CC(P(C(C)(C)C)C(C)(C)C)(C)C
InChIKey WZSDLZKWVLAZCJ-UHFFFAOYSA-L
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1)?

Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) is a crystalline compound with a molecular ...

Compound Q&A

What industries use iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1)?

Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) is widely used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1)?

Proper handling of iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) requires the use of pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...