Compound Q&A

What are the physical and chemical properties of Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1)?

Answer

Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1)
Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) is a crystalline compound with a molecular weight of approximately 434.5 g/mol. It is poorly soluble in water but soluble in common organic solvents like ethanol and acetone. The compound is highly reactive and can undergo various chemical transformations, making it useful in catalytic processes.

About

English Name Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1)
Molecular Formula C24H54I2P2Pd2
Molecular Weight 871.29 g/mol
SMILES [I]1[Pd][I][Pd]1.CC(P(C(C)(C)C)C(C)(C)C)(C)C.CC(P(C(C)(C)C)C(C)(C)C)(C)C
InChIKey WZSDLZKWVLAZCJ-UHFFFAOYSA-L
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

How is iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1) typically synthesized?

Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) is synthesized through the reaction of pall...

Compound Q&A

What industries use iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1)?

Iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) is widely used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) (CAS: 166445-62-1)?

Proper handling of iodopalladium - tris(2-methyl-2-propanyl)phosphine (1:1) requires the use of pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...