Compound Q&A

How is 5-Chloro-2-methoxyisonicotinic acid (CAS: 88912-22-5) typically synthesized?

Answer

5-Chloro-2-methoxyisonicotinic acid
5-Chloro-2-methoxyisonicotinic acid can be synthesized through the reaction of 2-methoxyisonicotinic chloride with sodium hydroxide. This process involves the substitution of a chlorine atom on the isonicotinic acid moiety, leading to a high yield of the desired product with good selectivity.

About

CAS No 88912-22-5
English Name 5-Chloro-2-methoxyisonicotinic acid
Molecular Formula C7H6ClNO3
Molecular Weight 187.58 g/mol
SMILES COC1=NC=C(C(=C1)C(=O)O)Cl
InChIKey LXHHWKXYDKBINP-UHFFFAOYSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-methoxyisonicotinic acid (CAS: 88912-22-5)?

5-Chloro-2-methoxyisonicotinic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use 5-Chloro-2-methoxyisonicotinic acid (CAS: 88912-22-5)?

5-Chloro-2-methoxyisonicotinic acid finds applications in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2-methoxyisonicotinic acid (CAS: 88912-22-5)?

When handling 5-Chloro-2-methoxyisonicotinic acid, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...