Compound Q&A

What industries use Lymecycline (CAS: 992-21-2)?

Answer

Lymecycline (85%)
Lymecycline (CAS: 992-21-2) is primarily used in the pharmaceutical industry for treating bacterial infections in humans and animals. It is also utilized in veterinary medicine to prevent and treat various bacterial diseases in livestock and poultry. Additionally, it has applications in agriculture, although its use is limited due to antibiotic resistance concerns.

About

CAS No 992-21-2
English Name Lymecycline (85%)
Molecular Formula C29H38N4O10
Molecular Weight 602.64 g/mol
SMILES CC1(C2CC3C(C(=O)C(=C(C3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)NCNCCCCC(C(=O)O)N)N(C)C)O
InChIKey AHEVKYYGXVEWNO-UEPZRUIBSA-N
Last Updated: 2025-12-28 06:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lymecycline (CAS: 992-21-2)?

Lymecycline (CAS: 992-21-2) is a semi-synthetic tetracycline antibiotic with a crystalline form. Its...

Compound Q&A

How is Lymecycline (CAS: 992-21-2) typically synthesized?

Lymecycline (CAS: 992-21-2) is typically synthesized through a series of steps, starting from chlort...

Compound Q&A

What precautions should be taken when handling Lymecycline (CAS: 992-21-2)?

When handling Lymecycline (CAS: 992-21-2), it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...