Compound Q&A

How should 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8) be stored?

Answer

3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide
This compound should be stored in a cool, dry place, away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent exposure to moisture and light. Storage conditions should be controlled to maintain the stability and effectiveness of the compound.

About

CAS No 51920-12-8
English Name 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide
Molecular Formula C27H24N6O6S
Molecular Weight 560.59 g/mol
SMILES Cc1cc(c(cc1S(=O)(=O)NC)OC)/N=N/c2c3ccccc3cc(c2O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5
InChIKey YKGGTUUWVUHZIL-ULIFNZDWSA-N
Last Updated: 2025-12-28 00:35

Related Q&A

Compound Q&A

What is 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8)?

This compound is a complex organic molecule with a unique structure, featuring a naphthamide ring, a...

Compound Q&A

What are the main uses of 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8)?

The compound is primarily used in the pharmaceutical industry for the development of drugs, particul...

Compound Q&A

Is 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8) safe?

The safety of this compound depends on the conditions of use. It is generally considered safe when h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...