Compound Q&A

What is 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8)?

Answer

3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide
This compound is a complex organic molecule with a unique structure, featuring a naphthamide ring, a benzimidazole ring, and a diazenyl group. It is characterized by its hydroxy and methylsulfamoyl functionalities. The compound is used in various applications including pharmaceuticals and research due to its specific chemical properties.

About

CAS No 51920-12-8
English Name 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide
Molecular Formula C27H24N6O6S
Molecular Weight 560.59 g/mol
SMILES Cc1cc(c(cc1S(=O)(=O)NC)OC)/N=N/c2c3ccccc3cc(c2O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5
InChIKey YKGGTUUWVUHZIL-ULIFNZDWSA-N
Last Updated: 2025-12-28 00:35

Related Q&A

Compound Q&A

What are the main uses of 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8)?

The compound is primarily used in the pharmaceutical industry for the development of drugs, particul...

Compound Q&A

Is 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8) safe?

The safety of this compound depends on the conditions of use. It is generally considered safe when h...

Compound Q&A

How should 3-Hydroxy-4-{(E)-[2-methoxy-5-methyl-4-(methylsulfamoyl)phenyl]diazenyl}-N-(2-oxo-2,3-dihydro-1H-benzimidazol-5-yl)-2-naphthamide (CAS: 51920-12-8) be stored?

This compound should be stored in a cool, dry place, away from direct sunlight and heat sources. It ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...