Compound Q&A

How should [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) be stored?

Answer

{[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid
[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) should be stored in a cool, dry place away from direct sunlight and heat sources. Maintain a consistent temperature below 25°C and keep the container tightly sealed to prevent moisture and air from entering. Store it in a secure, labeled container to prevent accidental spills or exposures. Avoid contact with incompatible materials, and ensure it is stored in a well-ventilated area for safety and stability purposes.

About

English Name {[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid
Molecular Formula C19H29O6P
Molecular Weight 368.41 g/mol
SMILES CCC(=O)OC(C(C)C)OP(=O)(CCCCC1=CC=CC=C1)CC(=O)O
InChIKey BGHVPSAAFKIBID-UHFFFAOYSA-N
Last Updated: 2025-12-27 17:44

Related Q&A

Compound Q&A

What is [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0)?

[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid is a complex organic compoun...

Compound Q&A

What are the main uses of [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0)?

[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) finds app...

Compound Q&A

Is [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) safe?

The safety of [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-7...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...