Compound Q&A

Is [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) safe?

Answer

{[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid
The safety of [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) depends on the specific context of its use. It is generally safe when handled with proper protective measures, such as gloves and goggles. However, care must be taken to avoid inhalation, ingestion, or contact with skin and eyes, as it may irritate these areas. Ensure proper ventilation during use and store it in a secure, well-ventilated area away from heat sources and incompatible materials.

About

English Name {[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid
Molecular Formula C19H29O6P
Molecular Weight 368.41 g/mol
SMILES CCC(=O)OC(C(C)C)OP(=O)(CCCCC1=CC=CC=C1)CC(=O)O
InChIKey BGHVPSAAFKIBID-UHFFFAOYSA-N
Last Updated: 2025-12-27 17:44

Related Q&A

Compound Q&A

What is [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0)?

[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid is a complex organic compoun...

Compound Q&A

What are the main uses of [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0)?

[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) finds app...

Compound Q&A

How should [2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) be stored?

[2-Methyl-1-(propionyloxy)propoxy](4-phenylbutyl)phosphoryl}acetic acid (CAS: 123599-78-0) should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...