Compound Q&A

How should Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7) be stored?

Answer

Naratriptan-d3 Hydrochloride
Naratriptan-d3 Hydrochloride should be stored in a tightly sealed container to protect it from moisture and light. It should be kept at room temperature (15-30°C) and away from direct sunlight. Avoid storing it in humid or high-temperature environments to maintain its stability and integrity.

About

English Name Naratriptan-d3 Hydrochloride
Molecular Formula C17H23ClD3N3O2S
Molecular Weight 374.95 g/mol
SMILES CNS(=O)(=O)CCc1ccc2c(c1)c(c[nH]2)C1CCN(CC1)C([2H])([2H])[2H].Cl
InChIKey AWEZYKMQFAUBTD-MUTAZJQDSA-N
Last Updated: 2025-12-27 06:56

Related Q&A

Compound Q&A

What is Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7)?

Naratriptan-d3 Hydrochloride is a stable isotope-labeled compound used in the research and developme...

Compound Q&A

What are the main uses of Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7)?

Naratriptan-d3 Hydrochloride is primarily used in the pharmaceutical industry for the research and d...

Compound Q&A

Is Naratriptan-d3 Hydrochloride (CAS: 1190021-64-7) safe?

Naratriptan-d3 Hydrochloride is generally considered safe when handled with proper safety precaution...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...